C20H25N5O7 — CID 66754342
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[(2,4,5-trimethoxyphenyl)methylamino]purin-9-yl]oxolane-3,4-diol (PubChem CID 66754342) has the molecular formula C20H25N5O7 and a molecular weight of 447.45 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[(2,4,5-trimethoxyphenyl)methylamino]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[(2,4,5-trimethoxyphenyl)methylamino]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 66754342 |
| Molecular Formula | C20H25N5O7 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[(2,4,5-trimethoxyphenyl)methylamino]purin-9-yl]oxolane-3,4-diol |
| SMILES | COc1cc(OC)c(OC)cc1CNc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H25N5O7/c1-29-11-5-13(31-3)12(30-2)4-10(11)6-21-18-15-19(23-8-22-18)25(9-24-15)20-17(28)16(27)14(7-26)32-20/h4-5,8-9,14,16-17,20,26-28H,6-7H2,1-3H3,(H,21,22,23)/t14-,16-,17-,20-/m1/s1 |
| InChIKey | DTHGAZMFCPSGBS-WVSUBDOOSA-N |
| XLogP | 0.08 |
| TPSA | 153.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |