C19H23N5O7 — CID 66753993
(2R,3R,4S,5R)-2-[6-[(2-hydroxy-3,6-dimethoxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 66753993) has the molecular formula C19H23N5O7 and a molecular weight of 433.42 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-[(2-hydroxy-3,6-dimethoxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-[(2-hydroxy-3,6-dimethoxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 66753993 |
| Molecular Formula | C19H23N5O7 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-[(2-hydroxy-3,6-dimethoxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | COc1ccc(OC)c(CNc2ncnc3c2ncn3[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1O |
| InChI | InChI=1S/C19H23N5O7/c1-29-10-3-4-11(30-2)14(26)9(10)5-20-17-13-18(22-7-21-17)24(8-23-13)19-16(28)15(27)12(6-25)31-19/h3-4,7-8,12,15-16,19,25-28H,5-6H2,1-2H3,(H,20,21,22)/t12-,15-,16-,19-/m1/s1 |
| InChIKey | VDYZTSSVXGVYLN-BGIGGGFGSA-N |
| XLogP | -0.23 |
| TPSA | 164.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|