C20H25N5O8 — CID 87135818
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[(6-hydroxy-2,3,4-trimethoxyphenyl)methylamino]purin-9-yl]oxolane-3,4-diol (PubChem CID 87135818) has the molecular formula C20H25N5O8 and a molecular weight of 463.45 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[(6-hydroxy-2,3,4-trimethoxyphenyl)methylamino]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[(6-hydroxy-2,3,4-trimethoxyphenyl)methylamino]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 87135818 |
| Molecular Formula | C20H25N5O8 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[(6-hydroxy-2,3,4-trimethoxyphenyl)methylamino]purin-9-yl]oxolane-3,4-diol |
| SMILES | COc1cc(O)c(CNc2ncnc3c2ncn3[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(OC)c1OC |
| InChI | InChI=1S/C20H25N5O8/c1-30-11-4-10(27)9(16(31-2)17(11)32-3)5-21-18-13-19(23-7-22-18)25(8-24-13)20-15(29)14(28)12(6-26)33-20/h4,7-8,12,14-15,20,26-29H,5-6H2,1-3H3,(H,21,22,23)/t12-,14-,15-,20-/m1/s1 |
| InChIKey | VJTBJCOCDUPEFW-FNSSNTJLSA-N |
| XLogP | -0.22 |
| TPSA | 173.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|