C23H22FN3O9 — CID 25224090
methyl 1-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-5-[2-(4-fluorophenyl)ethynyl]-1,2,4-triazole-3-carboxylate (PubChem CID 25224090) has the molecular formula C23H22FN3O9 and a molecular weight of 503.44 g/mol. Its IUPAC name is methyl 1-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-5-[2-(4-fluorophenyl)ethynyl]-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 1-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-5-[2-(4-fluorophenyl)ethynyl]-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 25224090 |
| Molecular Formula | C23H22FN3O9 |
| Molecular Weight | 503.44 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | methyl 1-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-5-[2-(4-fluorophenyl)ethynyl]-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1nc(C#Cc2ccc(F)cc2)n([C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)n1 |
| InChI | InChI=1S/C23H22FN3O9/c1-12(28)33-11-17-19(34-13(2)29)20(35-14(3)30)22(36-17)27-18(25-21(26-27)23(31)32-4)10-7-15-5-8-16(24)9-6-15/h5-6,8-9,17,19-20,22H,11H2,1-4H3/t17-,19-,20-,22-/m1/s1 |
| InChIKey | GJWQIFKZZMXKKZ-JWUVWSEFSA-N |
| XLogP | 0.93 |
| TPSA | 145.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.44 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|