C13H16N4O10 — CID 135578047
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(3-nitro-5-oxo-4H-1,2,4-triazol-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 135578047) has the molecular formula C13H16N4O10 and a molecular weight of 388.29 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(3-nitro-5-oxo-4H-1,2,4-triazol-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(3-nitro-5-oxo-4H-1,2,4-triazol-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135578047 |
| Molecular Formula | C13H16N4O10 |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(3-nitro-5-oxo-4H-1,2,4-triazol-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2nc([N+](=O)[O-])[nH]c2=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H16N4O10/c1-5(18)24-4-8-9(25-6(2)19)10(26-7(3)20)11(27-8)16-13(21)14-12(15-16)17(22)23/h8-11H,4H2,1-3H3,(H,14,15,21)/t8-,9-,10-,11-/m1/s1 |
| InChIKey | ZFYPBACGXJTAAC-GWOFURMSSA-N |
| XLogP | -1.20 |
| TPSA | 181.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|