C19H26N4O11 — CID 124898576
[(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[6-(dimethylamino)-3,5-dioxo-1,2,4-triazin-2-yl]oxan-2-yl]methyl acetate (PubChem CID 124898576) has the molecular formula C19H26N4O11 and a molecular weight of 486.43 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[6-(dimethylamino)-3,5-dioxo-1,2,4-triazin-2-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[6-(dimethylamino)-3,5-dioxo-1,2,4-triazin-2-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124898576 |
| Molecular Formula | C19H26N4O11 |
| Molecular Weight | 486.43 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[6-(dimethylamino)-3,5-dioxo-1,2,4-triazin-2-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](n2nc(N(C)C)c(=O)[nH]c2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H26N4O11/c1-8(24)30-7-12-13(31-9(2)25)14(32-10(3)26)15(33-11(4)27)18(34-12)23-19(29)20-17(28)16(21-23)22(5)6/h12-15,18H,7H2,1-6H3,(H,20,28,29)/t12-,13-,14-,15+,18-/m0/s1 |
| InChIKey | FJUIGBPJSWMBOZ-IBTNMTNLSA-N |
| XLogP | -1.75 |
| TPSA | 185.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.43 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|