C23H25N3O7 — CID 58292369
methyl 1-[(2R,3S,5R)-3,4-diacetyloxy-5-ethyloxolan-2-yl]-5-[2-(4-methylphenyl)ethynyl]-1,2,4-triazole-3-carboxylate (PubChem CID 58292369) has the molecular formula C23H25N3O7 and a molecular weight of 455.47 g/mol. Its IUPAC name is methyl 1-[(2R,3S,5R)-3,4-diacetyloxy-5-ethyloxolan-2-yl]-5-[2-(4-methylphenyl)ethynyl]-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 1-[(2R,3S,5R)-3,4-diacetyloxy-5-ethyloxolan-2-yl]-5-[2-(4-methylphenyl)ethynyl]-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 58292369 |
| Molecular Formula | C23H25N3O7 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | methyl 1-[(2R,3S,5R)-3,4-diacetyloxy-5-ethyloxolan-2-yl]-5-[2-(4-methylphenyl)ethynyl]-1,2,4-triazole-3-carboxylate |
| SMILES | CC[C@H]1O[C@@H](n2nc(C(=O)OC)nc2C#Cc2ccc(C)cc2)[C@@H](OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C23H25N3O7/c1-6-17-19(31-14(3)27)20(32-15(4)28)22(33-17)26-18(24-21(25-26)23(29)30-5)12-11-16-9-7-13(2)8-10-16/h7-10,17,19-20,22H,6H2,1-5H3/t17-,19?,20+,22-/m1/s1 |
| InChIKey | ZEKGRXFFZBKNMX-FTNJLOLWSA-N |
| XLogP | 1.94 |
| TPSA | 118.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|