C17H27N3O6Si — CID 159365981
[(2R,3S,5R)-4-acetyloxy-2-ethyl-5-[2-oxo-4-(trimethylsilylamino)pyrimidin-1-yl]oxolan-3-yl] acetate (PubChem CID 159365981) has the molecular formula C17H27N3O6Si and a molecular weight of 397.50 g/mol. Its IUPAC name is [(2R,3S,5R)-4-acetyloxy-2-ethyl-5-[2-oxo-4-(trimethylsilylamino)pyrimidin-1-yl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-4-acetyloxy-2-ethyl-5-[2-oxo-4-(trimethylsilylamino)pyrimidin-1-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 159365981 |
| Molecular Formula | C17H27N3O6Si |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | [(2R,3S,5R)-4-acetyloxy-2-ethyl-5-[2-oxo-4-(trimethylsilylamino)pyrimidin-1-yl]oxolan-3-yl] acetate |
| SMILES | CC[C@H]1O[C@@H](n2ccc(N[Si](C)(C)C)nc2=O)C(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H27N3O6Si/c1-7-12-14(24-10(2)21)15(25-11(3)22)16(26-12)20-9-8-13(18-17(20)23)19-27(4,5)6/h8-9,12,14-16H,7H2,1-6H3,(H,18,19,23)/t12-,14+,15?,16-/m1/s1 |
| InChIKey | XVJJTGSYEZPOSP-DJFRYGSHSA-N |
| XLogP | 1.66 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|