C21H22N2O8 — CID 162409698
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2-oxo-4-phenylpyrimidin-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 162409698) has the molecular formula C21H22N2O8 and a molecular weight of 430.41 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2-oxo-4-phenylpyrimidin-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2-oxo-4-phenylpyrimidin-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162409698 |
| Molecular Formula | C21H22N2O8 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2-oxo-4-phenylpyrimidin-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2ccc(-c3ccccc3)nc2=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H22N2O8/c1-12(24)28-11-17-18(29-13(2)25)19(30-14(3)26)20(31-17)23-10-9-16(22-21(23)27)15-7-5-4-6-8-15/h4-10,17-20H,11H2,1-3H3/t17-,18-,19-,20-/m1/s1 |
| InChIKey | OYMKAKZLJYNTNP-UAFMIMERSA-N |
| XLogP | 1.23 |
| TPSA | 123.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|