C18H18Cl2N2O7 — CID 10646980
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,6-dichlorobenzimidazol-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 10646980) has the molecular formula C18H18Cl2N2O7 and a molecular weight of 445.26 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,6-dichlorobenzimidazol-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,6-dichlorobenzimidazol-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10646980 |
| Molecular Formula | C18H18Cl2N2O7 |
| Molecular Weight | 445.26 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,6-dichlorobenzimidazol-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(Cl)nc3ccc(Cl)cc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H18Cl2N2O7/c1-8(23)26-7-14-15(27-9(2)24)16(28-10(3)25)17(29-14)22-13-6-11(19)4-5-12(13)21-18(22)20/h4-6,14-17H,7H2,1-3H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | UZZFCODXFXEOCZ-QBPKDAKJSA-N |
| XLogP | 2.67 |
| TPSA | 105.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|