C19H22ClNO7S — CID 67808982
[(2R,3R,4S,4aS,10aS)-3,4-diacetyloxy-8-chloro-10-methyl-3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b][1,4]benzothiazin-2-yl]methyl acetate (PubChem CID 67808982) has the molecular formula C19H22ClNO7S and a molecular weight of 443.91 g/mol. Its IUPAC name is [(2R,3R,4S,4aS,10aS)-3,4-diacetyloxy-8-chloro-10-methyl-3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b][1,4]benzothiazin-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,4aS,10aS)-3,4-diacetyloxy-8-chloro-10-methyl-3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b][1,4]benzothiazin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 67808982 |
| Molecular Formula | C19H22ClNO7S |
| Molecular Weight | 443.91 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | [(2R,3R,4S,4aS,10aS)-3,4-diacetyloxy-8-chloro-10-methyl-3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b][1,4]benzothiazin-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H]2[C@@H](Sc3ccc(Cl)cc3N2C)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H22ClNO7S/c1-9(22)25-8-14-16(26-10(2)23)17(27-11(3)24)18-19(28-14)21(4)13-7-12(20)5-6-15(13)29-18/h5-7,14,16-19H,8H2,1-4H3/t14-,16-,17+,18+,19+/m1/s1 |
| InChIKey | CEECUEZTZVTQQI-IQRFUGTFSA-N |
| XLogP | 2.40 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.91 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|