C16H18ClNO5 — CID 101333901
[(1R,9R,10S,11R)-10-acetyloxy-5-chloro-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-yl]methyl acetate (PubChem CID 101333901) has the molecular formula C16H18ClNO5 and a molecular weight of 339.78 g/mol. Its IUPAC name is [(1R,9R,10S,11R)-10-acetyloxy-5-chloro-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-yl]methyl acetate.
| Compound Name | [(1R,9R,10S,11R)-10-acetyloxy-5-chloro-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-yl]methyl acetate |
|---|---|
| PubChem CID | 101333901 |
| Molecular Formula | C16H18ClNO5 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | [(1R,9R,10S,11R)-10-acetyloxy-5-chloro-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]2C[C@@H](Nc3cc(Cl)ccc32)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H18ClNO5/c1-8(19)21-7-15-16(22-9(2)20)13-6-14(23-15)11-4-3-10(17)5-12(11)18-13/h3-5,13-16,18H,6-7H2,1-2H3/t13-,14-,15-,16+/m1/s1 |
| InChIKey | DNSQSTONLUWWKU-FPCVCCKLSA-N |
| XLogP | 2.46 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |