C21H24N2O9S — CID 86633130
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(2-sulfanylidene-3H-benzimidazol-1-yl)oxan-2-yl]methyl acetate (PubChem CID 86633130) has the molecular formula C21H24N2O9S and a molecular weight of 480.50 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(2-sulfanylidene-3H-benzimidazol-1-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(2-sulfanylidene-3H-benzimidazol-1-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 86633130 |
| Molecular Formula | C21H24N2O9S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(2-sulfanylidene-3H-benzimidazol-1-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(n2c(=S)[nH]c3ccccc32)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H24N2O9S/c1-10(24)28-9-16-17(29-11(2)25)18(30-12(3)26)19(31-13(4)27)20(32-16)23-15-8-6-5-7-14(15)22-21(23)33/h5-8,16-20H,9H2,1-4H3,(H,22,33)/t16-,17-,18+,19-,20?/m1/s1 |
| InChIKey | LUDJONSOAAVRLR-QUIYGKKVSA-N |
| XLogP | 1.95 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|