C30H31NO11 — CID 132507378
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-(4-methoxyphenyl)-2-oxoquinolin-1-yl]oxan-2-yl]methyl acetate (PubChem CID 132507378) has the molecular formula C30H31NO11 and a molecular weight of 581.57 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-(4-methoxyphenyl)-2-oxoquinolin-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-(4-methoxyphenyl)-2-oxoquinolin-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 132507378 |
| Molecular Formula | C30H31NO11 |
| Molecular Weight | 581.57 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-(4-methoxyphenyl)-2-oxoquinolin-1-yl]oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(-c2cc(=O)n([C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C30H31NO11/c1-16(32)38-15-25-27(39-17(2)33)28(40-18(3)34)29(41-19(4)35)30(42-25)31-24-9-7-6-8-22(24)23(14-26(31)36)20-10-12-21(37-5)13-11-20/h6-14,25,27-30H,15H2,1-5H3/t25-,27-,28+,29-,30-/m1/s1 |
| InChIKey | SULKDZPFWLBYAL-LXRLAABLSA-N |
| XLogP | 2.93 |
| TPSA | 145.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|