C31H30N2O11 — CID 3005847
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-cyano-4-(furan-2-yl)-6-(4-methylphenyl)-2-oxo-1-pyridinyl]oxan-2-yl]methyl acetate (PubChem CID 3005847) has the molecular formula C31H30N2O11 and a molecular weight of 606.58 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-cyano-4-(furan-2-yl)-6-(4-methylphenyl)-2-oxo-1-pyridinyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-cyano-4-(furan-2-yl)-6-(4-methylphenyl)-2-oxo-1-pyridinyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 3005847 |
| Molecular Formula | C31H30N2O11 |
| Molecular Weight | 606.58 g/mol |
| Exact Mass | 606.18 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-cyano-4-(furan-2-yl)-6-(4-methylphenyl)-2-oxo-1-pyridinyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(-c3ccc(C)cc3)cc(-c3ccco3)c(C#N)c2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C31H30N2O11/c1-16-8-10-21(11-9-16)24-13-22(25-7-6-12-39-25)23(14-32)30(38)33(24)31-29(43-20(5)37)28(42-19(4)36)27(41-18(3)35)26(44-31)15-40-17(2)34/h6-13,26-29,31H,15H2,1-5H3/t26-,27-,28+,29-,31-/m1/s1 |
| InChIKey | OJDBOPGTTSDXSZ-PAVKSNICSA-N |
| XLogP | 3.21 |
| TPSA | 173.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|