C23H25NO11S2 — CID 98535827
[(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[(5Z)-5-[1-(furan-2-yl)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate (PubChem CID 98535827) has the molecular formula C23H25NO11S2 and a molecular weight of 555.58 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[(5Z)-5-[1-(furan-2-yl)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[(5Z)-5-[1-(furan-2-yl)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 98535827 |
| Molecular Formula | C23H25NO11S2 |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | [(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[(5Z)-5-[1-(furan-2-yl)ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@@H](N2C(=O)/C(=C(\C)c3ccco3)SC2=S)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H25NO11S2/c1-10(15-7-6-8-30-15)20-21(29)24(23(36)37-20)22-19(34-14(5)28)18(33-13(4)27)17(32-12(3)26)16(35-22)9-31-11(2)25/h6-8,16-19,22H,9H2,1-5H3/b20-10-/t16-,17+,18+,19+,22+/m0/s1 |
| InChIKey | DSEOOPSSKVYEFC-MMGVDFNNSA-N |
| XLogP | 1.95 |
| TPSA | 147.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|