C24H23Cl2NO10S2 — CID 131882861
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate (PubChem CID 131882861) has the molecular formula C24H23Cl2NO10S2 and a molecular weight of 620.49 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 131882861 |
| Molecular Formula | C24H23Cl2NO10S2 |
| Molecular Weight | 620.49 g/mol |
| Exact Mass | 619.01 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](N2C(=O)C(=Cc3c(Cl)cccc3Cl)SC2=S)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H23Cl2NO10S2/c1-10(28)33-9-17-19(34-11(2)29)20(35-12(3)30)21(36-13(4)31)23(37-17)27-22(32)18(39-24(27)38)8-14-15(25)6-5-7-16(14)26/h5-8,17,19-21,23H,9H2,1-4H3/t17-,19-,20+,21-,23-/m1/s1 |
| InChIKey | NCNFIPGSFSXSRE-OXUVVOBNSA-N |
| XLogP | 3.28 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|