C25H25NO12S2 — CID 125028828
[(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate (PubChem CID 125028828) has the molecular formula C25H25NO12S2 and a molecular weight of 595.60 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 125028828 |
| Molecular Formula | C25H25NO12S2 |
| Molecular Weight | 595.60 g/mol |
| Exact Mass | 595.08 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](N2C(=O)/C(=C\c3ccc4c(c3)OCO4)SC2=S)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C25H25NO12S2/c1-11(27)32-9-18-20(35-12(2)28)21(36-13(3)29)22(37-14(4)30)24(38-18)26-23(31)19(40-25(26)39)8-15-5-6-16-17(7-15)34-10-33-16/h5-8,18,20-22,24H,9-10H2,1-4H3/b19-8+/t18-,20-,21-,22+,24-/m0/s1 |
| InChIKey | AMQDJPMOQFQPQJ-CWJHOHPISA-N |
| XLogP | 1.70 |
| TPSA | 153.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.60 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|