C26H29NO12S2 — CID 5477009
[3,4,5-triacetyloxy-6-[(5Z)-5-[(2,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate (PubChem CID 5477009) has the molecular formula C26H29NO12S2 and a molecular weight of 611.65 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[(5Z)-5-[(2,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[(5Z)-5-[(2,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 5477009 |
| Molecular Formula | C26H29NO12S2 |
| Molecular Weight | 611.65 g/mol |
| Exact Mass | 611.11 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[(5Z)-5-[(2,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(OC)c(/C=C2\SC(=S)N(C3OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C3OC(C)=O)C2=O)c1 |
| InChI | InChI=1S/C26H29NO12S2/c1-12(28)35-11-19-21(36-13(2)29)22(37-14(3)30)23(38-15(4)31)25(39-19)27-24(32)20(41-26(27)40)10-16-9-17(33-5)7-8-18(16)34-6/h7-10,19,21-23,25H,11H2,1-6H3/b20-10- |
| InChIKey | JQTATGPAKLXPCI-JMIUGGIZSA-N |
| XLogP | 1.99 |
| TPSA | 153.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.65 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|