C16H17NO5S3 — CID 11947603
(5E)-5-[(2,5-dimethoxyphenyl)methylidene]-3-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 11947603) has the molecular formula C16H17NO5S3 and a molecular weight of 399.52 g/mol. Its IUPAC name is (5E)-5-[(2,5-dimethoxyphenyl)methylidene]-3-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(2,5-dimethoxyphenyl)methylidene]-3-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 11947603 |
| Molecular Formula | C16H17NO5S3 |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | (5E)-5-[(2,5-dimethoxyphenyl)methylidene]-3-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(OC)c(/C=C2/SC(=S)N(C3CCS(=O)(=O)C3)C2=O)c1 |
| InChI | InChI=1S/C16H17NO5S3/c1-21-12-3-4-13(22-2)10(7-12)8-14-15(18)17(16(23)24-14)11-5-6-25(19,20)9-11/h3-4,7-8,11H,5-6,9H2,1-2H3/b14-8+ |
| InChIKey | PGFUXZXHEWPFMP-RIYZIHGNSA-N |
| XLogP | 2.09 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|