C22H21NO5S3 — CID 45047445
(5E)-3-(1,1-dioxothiolan-3-yl)-5-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 45047445) has the molecular formula C22H21NO5S3 and a molecular weight of 475.61 g/mol. Its IUPAC name is (5E)-3-(1,1-dioxothiolan-3-yl)-5-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(1,1-dioxothiolan-3-yl)-5-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 45047445 |
| Molecular Formula | C22H21NO5S3 |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | (5E)-3-(1,1-dioxothiolan-3-yl)-5-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2/SC(=S)N(C3CCS(=O)(=O)C3)C2=O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H21NO5S3/c1-27-19-11-16(7-8-18(19)28-13-15-5-3-2-4-6-15)12-20-21(24)23(22(29)30-20)17-9-10-31(25,26)14-17/h2-8,11-12,17H,9-10,13-14H2,1H3/b20-12+ |
| InChIKey | RVXVTFZGWSCFLZ-UDWIEESQSA-N |
| XLogP | 3.66 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|