C16H17NO3S3 — CID 1324080
(5E)-3-[(3R)-1,1-dioxothiolan-3-yl]-5-[(4-ethylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 1324080) has the molecular formula C16H17NO3S3 and a molecular weight of 367.52 g/mol. Its IUPAC name is (5E)-3-[(3R)-1,1-dioxothiolan-3-yl]-5-[(4-ethylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-[(3R)-1,1-dioxothiolan-3-yl]-5-[(4-ethylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1324080 |
| Molecular Formula | C16H17NO3S3 |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | (5E)-3-[(3R)-1,1-dioxothiolan-3-yl]-5-[(4-ethylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCc1ccc(/C=C2/SC(=S)N([C@@H]3CCS(=O)(=O)C3)C2=O)cc1 |
| InChI | InChI=1S/C16H17NO3S3/c1-2-11-3-5-12(6-4-11)9-14-15(18)17(16(21)22-14)13-7-8-23(19,20)10-13/h3-6,9,13H,2,7-8,10H2,1H3/b14-9+/t13-/m1/s1 |
| InChIKey | MAKMYOFOHUCGCB-OZYJXZHSSA-N |
| XLogP | 2.64 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|