C16H17NO5S3 — CID 11947601
(5E)-3-(1,1-dioxothiolan-3-yl)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 11947601) has the molecular formula C16H17NO5S3 and a molecular weight of 399.52 g/mol. Its IUPAC name is (5E)-3-(1,1-dioxothiolan-3-yl)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(1,1-dioxothiolan-3-yl)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 11947601 |
| Molecular Formula | C16H17NO5S3 |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | (5E)-3-(1,1-dioxothiolan-3-yl)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(C3CCS(=O)(=O)C3)C2=O)ccc1O |
| InChI | InChI=1S/C16H17NO5S3/c1-2-22-13-7-10(3-4-12(13)18)8-14-15(19)17(16(23)24-14)11-5-6-25(20,21)9-11/h3-4,7-8,11,18H,2,5-6,9H2,1H3/b14-8+ |
| InChIKey | ADITYYFLLLZPID-RIYZIHGNSA-N |
| XLogP | 2.18 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|