C15H15NO3S3 — CID 2843792
3-(1,1-dioxothiolan-3-yl)-5-[(4-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 2843792) has the molecular formula C15H15NO3S3 and a molecular weight of 353.49 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-5-[(4-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-5-[(4-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2843792 |
| Molecular Formula | C15H15NO3S3 |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-5-[(4-methylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(C=C2SC(=S)N(C3CCS(=O)(=O)C3)C2=O)cc1 |
| InChI | InChI=1S/C15H15NO3S3/c1-10-2-4-11(5-3-10)8-13-14(17)16(15(20)21-13)12-6-7-22(18,19)9-12/h2-5,8,12H,6-7,9H2,1H3 |
| InChIKey | CMEHPBNSDKSYTO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|