C17H19NO6S3 — CID 3851597
3-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 3851597) has the molecular formula C17H19NO6S3 and a molecular weight of 429.54 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3851597 |
| Molecular Formula | C17H19NO6S3 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(C=C2SC(=S)N(C3CCS(=O)(=O)C3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C17H19NO6S3/c1-22-12-6-10(7-13(23-2)15(12)24-3)8-14-16(19)18(17(25)26-14)11-4-5-27(20,21)9-11/h6-8,11H,4-5,9H2,1-3H3 |
| InChIKey | MJTFSBYILWSRQF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|