C26H25NO7S3 — CID 129374887
[4-[(Z)-[3-[(3S)-1,1-dioxothiolan-3-yl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 129374887) has the molecular formula C26H25NO7S3 and a molecular weight of 559.69 g/mol. Its IUPAC name is [4-[(Z)-[3-[(3S)-1,1-dioxothiolan-3-yl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [4-[(Z)-[3-[(3S)-1,1-dioxothiolan-3-yl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 129374887 |
| Molecular Formula | C26H25NO7S3 |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | [4-[(Z)-[3-[(3S)-1,1-dioxothiolan-3-yl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1cc(/C=C2\SC(=S)N([C@H]3CCS(=O)(=O)C3)C2=O)ccc1OC(=O)/C=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H25NO7S3/c1-3-33-22-14-18(15-23-25(29)27(26(35)36-23)19-12-13-37(30,31)16-19)6-10-21(22)34-24(28)11-7-17-4-8-20(32-2)9-5-17/h4-11,14-15,19H,3,12-13,16H2,1-2H3/b11-7+,23-15-/t19-/m0/s1 |
| InChIKey | BSFNKMDLAOQRDI-YCIFGCQNSA-N |
| XLogP | 4.10 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|