C25H27NO11S2 — CID 125028802
[(2R,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[(5E)-5-[(2-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate (PubChem CID 125028802) has the molecular formula C25H27NO11S2 and a molecular weight of 581.62 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[(5E)-5-[(2-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[(5E)-5-[(2-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 125028802 |
| Molecular Formula | C25H27NO11S2 |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.10 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[(5E)-5-[(2-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate |
| SMILES | COc1ccccc1/C=C1/SC(=S)N([C@@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O)C1=O |
| InChI | InChI=1S/C25H27NO11S2/c1-12(27)33-11-18-20(34-13(2)28)21(35-14(3)29)22(36-15(4)30)24(37-18)26-23(31)19(39-25(26)38)10-16-8-6-7-9-17(16)32-5/h6-10,18,20-22,24H,11H2,1-5H3/b19-10+/t18-,20+,21-,22+,24-/m1/s1 |
| InChIKey | OCFHPJUJYJNEHW-QOXLWOCNSA-N |
| XLogP | 1.98 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|