C33H32N2O10S — CID 96582536
[(2S,3R,4R,5S,6R)-6-(3-acetyl-5-cyano-2-methyl-4-naphthalen-1-yl-6-sulfanylidene-1-pyridinyl)-3,4,5-triacetyloxyoxan-2-yl]methyl acetate (PubChem CID 96582536) has the molecular formula C33H32N2O10S and a molecular weight of 648.69 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-6-(3-acetyl-5-cyano-2-methyl-4-naphthalen-1-yl-6-sulfanylidene-1-pyridinyl)-3,4,5-triacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4R,5S,6R)-6-(3-acetyl-5-cyano-2-methyl-4-naphthalen-1-yl-6-sulfanylidene-1-pyridinyl)-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 96582536 |
| Molecular Formula | C33H32N2O10S |
| Molecular Weight | 648.69 g/mol |
| Exact Mass | 648.18 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-6-(3-acetyl-5-cyano-2-methyl-4-naphthalen-1-yl-6-sulfanylidene-1-pyridinyl)-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@@H](n2c(C)c(C(C)=O)c(-c3cccc4ccccc34)c(C#N)c2=S)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C33H32N2O10S/c1-16-27(17(2)36)28(24-13-9-11-22-10-7-8-12-23(22)24)25(14-34)33(46)35(16)32-31(44-21(6)40)30(43-20(5)39)29(42-19(4)38)26(45-32)15-41-18(3)37/h7-13,26,29-32H,15H2,1-6H3/t26-,29+,30+,31-,32+/m0/s1 |
| InChIKey | KABGLUQHCDXHJE-OTVXFJNRSA-N |
| XLogP | 4.68 |
| TPSA | 160.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.69 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|