C27H29N3O9 — CID 56837473
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[(6-amino-5-cyano-4-phenyl-2-pyridinyl)methyl]oxan-2-yl]methyl acetate (PubChem CID 56837473) has the molecular formula C27H29N3O9 and a molecular weight of 539.54 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[(6-amino-5-cyano-4-phenyl-2-pyridinyl)methyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[(6-amino-5-cyano-4-phenyl-2-pyridinyl)methyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 56837473 |
| Molecular Formula | C27H29N3O9 |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[(6-amino-5-cyano-4-phenyl-2-pyridinyl)methyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Cc2cc(-c3ccccc3)c(C#N)c(N)n2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H29N3O9/c1-14(31)35-13-23-25(37-16(3)33)26(38-17(4)34)24(36-15(2)32)22(39-23)11-19-10-20(18-8-6-5-7-9-18)21(12-28)27(29)30-19/h5-10,22-26H,11,13H2,1-4H3,(H2,29,30)/t22-,23+,24-,25+,26+/m0/s1 |
| InChIKey | RUMYRCWYYYCZLA-NQUGZWMISA-N |
| XLogP | 1.87 |
| TPSA | 177.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|