C27H26ClFN2O9 — CID 53473353
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[[6-chloro-5-cyano-4-(4-fluorophenyl)-2-pyridinyl]methyl]oxan-2-yl]methyl acetate (PubChem CID 53473353) has the molecular formula C27H26ClFN2O9 and a molecular weight of 576.96 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[[6-chloro-5-cyano-4-(4-fluorophenyl)-2-pyridinyl]methyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[[6-chloro-5-cyano-4-(4-fluorophenyl)-2-pyridinyl]methyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 53473353 |
| Molecular Formula | C27H26ClFN2O9 |
| Molecular Weight | 576.96 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[[6-chloro-5-cyano-4-(4-fluorophenyl)-2-pyridinyl]methyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Cc2cc(-c3ccc(F)cc3)c(C#N)c(Cl)n2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H26ClFN2O9/c1-13(32)36-12-23-25(38-15(3)34)26(39-16(4)35)24(37-14(2)33)22(40-23)10-19-9-20(21(11-30)27(28)31-19)17-5-7-18(29)8-6-17/h5-9,22-26H,10,12H2,1-4H3/t22-,23+,24-,25+,26+/m0/s1 |
| InChIKey | WSUUHMNTRAXDGV-NQUGZWMISA-N |
| XLogP | 3.08 |
| TPSA | 151.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.96 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|