C41H36N2O11 — CID 139235567
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[3-cyano-4-(4-methoxyphenyl)-6-phenanthren-2-yl-2-pyridinyl]oxy]oxan-2-yl]methyl acetate (PubChem CID 139235567) has the molecular formula C41H36N2O11 and a molecular weight of 732.74 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[3-cyano-4-(4-methoxyphenyl)-6-phenanthren-2-yl-2-pyridinyl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[3-cyano-4-(4-methoxyphenyl)-6-phenanthren-2-yl-2-pyridinyl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139235567 |
| Molecular Formula | C41H36N2O11 |
| Molecular Weight | 732.74 g/mol |
| Exact Mass | 732.23 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[3-cyano-4-(4-methoxyphenyl)-6-phenanthren-2-yl-2-pyridinyl]oxy]oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(-c2cc(-c3ccc4c(ccc5ccccc54)c3)nc(O[C@@H]3O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)c2C#N)cc1 |
| InChI | InChI=1S/C41H36N2O11/c1-22(44)49-21-36-37(50-23(2)45)38(51-24(3)46)39(52-25(4)47)41(53-36)54-40-34(20-42)33(27-12-15-30(48-5)16-13-27)19-35(43-40)29-14-17-32-28(18-29)11-10-26-8-6-7-9-31(26)32/h6-19,36-39,41H,21H2,1-5H3/t36-,37+,38+,39-,41+/m1/s1 |
| InChIKey | BWSADTJZVFQXCJ-FXWJQBGMSA-N |
| XLogP | 6.06 |
| TPSA | 169.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.74 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|