C30H30O14 — CID 162855222
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[7-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-8-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 162855222) has the molecular formula C30H30O14 and a molecular weight of 614.56 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[7-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-8-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[7-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-8-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162855222 |
| Molecular Formula | C30H30O14 |
| Molecular Weight | 614.56 g/mol |
| Exact Mass | 614.16 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[7-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-8-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | COc1ccc(-c2coc3c(O[C@@H]4O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]4OC(C)=O)c(O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C30H30O14/c1-14(31)38-13-23-27(40-15(2)32)28(41-16(3)33)29(42-17(4)34)30(43-23)44-26-22(35)11-10-20-24(36)21(12-39-25(20)26)18-6-8-19(37-5)9-7-18/h6-12,23,27-30,35H,13H2,1-5H3/t23-,27-,28+,29-,30+/m1/s1 |
| InChIKey | UBXSYQDOFIYMHL-LJIDESGUSA-N |
| XLogP | 2.64 |
| TPSA | 183.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.56 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|