C29H27ClO13 — CID 98468167
[(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[3-(4-chlorophenyl)-5-hydroxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 98468167) has the molecular formula C29H27ClO13 and a molecular weight of 618.98 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[3-(4-chlorophenyl)-5-hydroxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[3-(4-chlorophenyl)-5-hydroxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 98468167 |
| Molecular Formula | C29H27ClO13 |
| Molecular Weight | 618.98 g/mol |
| Exact Mass | 618.11 |
| IUPAC Name | [(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[3-(4-chlorophenyl)-5-hydroxy-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@@H](Oc2cc(O)c3c(=O)c(-c4ccc(Cl)cc4)coc3c2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H27ClO13/c1-13(31)37-12-23-26(39-14(2)32)27(40-15(3)33)28(41-16(4)34)29(43-23)42-19-9-21(35)24-22(10-19)38-11-20(25(24)36)17-5-7-18(30)8-6-17/h5-11,23,26-29,35H,12H2,1-4H3/t23-,26+,27-,28-,29+/m0/s1 |
| InChIKey | RXIOQRJGJTYZPF-FECQQHJKSA-N |
| XLogP | 3.28 |
| TPSA | 174.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.98 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|