C41H48O16 — CID 25156644
[4-[5-hexanoyloxy-4-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxychromen-3-yl]phenyl] hexanoate (PubChem CID 25156644) has the molecular formula C41H48O16 and a molecular weight of 796.82 g/mol. Its IUPAC name is [4-[5-hexanoyloxy-4-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxychromen-3-yl]phenyl] hexanoate.
| Compound Name | [4-[5-hexanoyloxy-4-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxychromen-3-yl]phenyl] hexanoate |
|---|---|
| PubChem CID | 25156644 |
| Molecular Formula | C41H48O16 |
| Molecular Weight | 796.82 g/mol |
| Exact Mass | 796.29 |
| IUPAC Name | [4-[5-hexanoyloxy-4-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxychromen-3-yl]phenyl] hexanoate |
| SMILES | CCCCCC(=O)Oc1ccc(-c2coc3cc(O[C@@H]4O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]4OC(C)=O)cc(OC(=O)CCCCC)c3c2=O)cc1 |
| InChI | InChI=1S/C41H48O16/c1-7-9-11-13-34(46)54-28-17-15-27(16-18-28)30-21-50-31-19-29(20-32(36(31)37(30)48)56-35(47)14-12-10-8-2)55-41-40(53-26(6)45)39(52-25(5)44)38(51-24(4)43)33(57-41)22-49-23(3)42/h15-21,33,38-41H,7-14,22H2,1-6H3/t33-,38-,39+,40-,41-/m1/s1 |
| InChIKey | DEXAMFSORHPENI-DFRCGMJJSA-N |
| XLogP | 5.89 |
| TPSA | 206.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.82 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|