C29H27BrO12 — CID 162844015
[(2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-(4-bromophenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 162844015) has the molecular formula C29H27BrO12 and a molecular weight of 647.43 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-(4-bromophenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-(4-bromophenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162844015 |
| Molecular Formula | C29H27BrO12 |
| Molecular Weight | 647.43 g/mol |
| Exact Mass | 646.07 |
| IUPAC Name | [(2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-(4-bromophenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@@H](Oc2ccc3c(=O)c(-c4ccc(Br)cc4)coc3c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H27BrO12/c1-14(31)36-13-24-26(38-15(2)32)27(39-16(3)33)28(40-17(4)34)29(42-24)41-20-9-10-21-23(11-20)37-12-22(25(21)35)18-5-7-19(30)8-6-18/h5-12,24,26-29H,13H2,1-4H3/t24-,26+,27-,28+,29+/m0/s1 |
| InChIKey | LLIDXSLTGXJBBQ-BDSYYVIYSA-N |
| XLogP | 3.68 |
| TPSA | 153.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|