C30H30O14 — CID 98468133
[(2R,3S,4S,5S,6S)-3,4,5-triacetyloxy-6-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 98468133) has the molecular formula C30H30O14 and a molecular weight of 614.56 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6S)-3,4,5-triacetyloxy-6-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5S,6S)-3,4,5-triacetyloxy-6-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 98468133 |
| Molecular Formula | C30H30O14 |
| Molecular Weight | 614.56 g/mol |
| Exact Mass | 614.16 |
| IUPAC Name | [(2R,3S,4S,5S,6S)-3,4,5-triacetyloxy-6-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | COc1ccc(Oc2coc3cc(O[C@@H]4O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]4OC(C)=O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C30H30O14/c1-15(31)37-14-25-27(39-16(2)32)28(40-17(3)33)29(41-18(4)34)30(44-25)43-21-10-11-22-23(12-21)38-13-24(26(22)35)42-20-8-6-19(36-5)7-9-20/h6-13,25,27-30H,14H2,1-5H3/t25-,27+,28+,29+,30-/m1/s1 |
| InChIKey | MRKBUKQVEVNIGL-VQXQMPIVSA-N |
| XLogP | 3.06 |
| TPSA | 172.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|