C27H27NO12S — CID 124711548
[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(4-methyl-1,3-thiazol-2-yl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 124711548) has the molecular formula C27H27NO12S and a molecular weight of 589.58 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(4-methyl-1,3-thiazol-2-yl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(4-methyl-1,3-thiazol-2-yl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124711548 |
| Molecular Formula | C27H27NO12S |
| Molecular Weight | 589.58 g/mol |
| Exact Mass | 589.13 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(4-methyl-1,3-thiazol-2-yl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](Oc2ccc3c(=O)c(-c4nc(C)cs4)coc3c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C27H27NO12S/c1-12-11-41-26(28-12)19-9-35-20-8-17(6-7-18(20)22(19)33)39-27-25(38-16(5)32)24(37-15(4)31)23(36-14(3)30)21(40-27)10-34-13(2)29/h6-9,11,21,23-25,27H,10H2,1-5H3/t21-,23-,24-,25+,27-/m0/s1 |
| InChIKey | LODGFUDXZVUDFR-DGCJFVAGSA-N |
| XLogP | 2.69 |
| TPSA | 166.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.58 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|