C35H38O14 — CID 25156641
[4-[4-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxychromen-3-yl]phenyl] hexanoate (PubChem CID 25156641) has the molecular formula C35H38O14 and a molecular weight of 682.67 g/mol. Its IUPAC name is [4-[4-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxychromen-3-yl]phenyl] hexanoate.
| Compound Name | [4-[4-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxychromen-3-yl]phenyl] hexanoate |
|---|---|
| PubChem CID | 25156641 |
| Molecular Formula | C35H38O14 |
| Molecular Weight | 682.67 g/mol |
| Exact Mass | 682.23 |
| IUPAC Name | [4-[4-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxychromen-3-yl]phenyl] hexanoate |
| SMILES | CCCCCC(=O)Oc1ccc(-c2coc3cc(O[C@@H]4O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]4OC(C)=O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C35H38O14/c1-6-7-8-9-30(40)47-24-12-10-23(11-13-24)27-17-43-28-16-25(14-15-26(28)31(27)41)48-35-34(46-22(5)39)33(45-21(4)38)32(44-20(3)37)29(49-35)18-42-19(2)36/h10-17,29,32-35H,6-9,18H2,1-5H3/t29-,32-,33+,34-,35-/m1/s1 |
| InChIKey | OEPFJMPMMRBHIB-MCEIUOFSSA-N |
| XLogP | 4.41 |
| TPSA | 180.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.67 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|