C31H26N2O3 — CID 139235559
2-(4-hydroxybutoxy)-4-(4-methoxyphenyl)-6-phenanthren-2-ylpyridine-3-carbonitrile (PubChem CID 139235559) has the molecular formula C31H26N2O3 and a molecular weight of 474.56 g/mol. Its IUPAC name is 2-(4-hydroxybutoxy)-4-(4-methoxyphenyl)-6-phenanthren-2-ylpyridine-3-carbonitrile.
| Compound Name | 2-(4-hydroxybutoxy)-4-(4-methoxyphenyl)-6-phenanthren-2-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 139235559 |
| Molecular Formula | C31H26N2O3 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 2-(4-hydroxybutoxy)-4-(4-methoxyphenyl)-6-phenanthren-2-ylpyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2cc(-c3ccc4c(ccc5ccccc54)c3)nc(OCCCCO)c2C#N)cc1 |
| InChI | InChI=1S/C31H26N2O3/c1-35-25-13-10-22(11-14-25)28-19-30(33-31(29(28)20-32)36-17-5-4-16-34)24-12-15-27-23(18-24)9-8-21-6-2-3-7-26(21)27/h2-3,6-15,18-19,34H,4-5,16-17H2,1H3 |
| InChIKey | DYXDIFSJHSHFMM-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 75.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|