C35H32O12 — CID 71714138
[(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[4-(4-methoxyphenyl)-9,10-dioxoanthracen-1-yl]oxan-2-yl]methyl acetate (PubChem CID 71714138) has the molecular formula C35H32O12 and a molecular weight of 644.63 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[4-(4-methoxyphenyl)-9,10-dioxoanthracen-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[4-(4-methoxyphenyl)-9,10-dioxoanthracen-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71714138 |
| Molecular Formula | C35H32O12 |
| Molecular Weight | 644.63 g/mol |
| Exact Mass | 644.19 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[4-(4-methoxyphenyl)-9,10-dioxoanthracen-1-yl]oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(-c2ccc([C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]3OC(C)=O)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C35H32O12/c1-17(36)43-16-27-33(44-18(2)37)35(46-20(4)39)34(45-19(3)38)32(47-27)26-15-14-23(21-10-12-22(42-5)13-11-21)28-29(26)31(41)25-9-7-6-8-24(25)30(28)40/h6-15,27,32-35H,16H2,1-5H3/t27-,32+,33-,34-,35+/m1/s1 |
| InChIKey | JOBNMTITVRJSIN-UOVXLZKXSA-N |
| XLogP | 3.94 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.63 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|