C24H29NO10 — CID 102151331
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(5-methoxy-1-methylindol-3-yl)oxan-2-yl]methyl acetate (PubChem CID 102151331) has the molecular formula C24H29NO10 and a molecular weight of 491.49 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(5-methoxy-1-methylindol-3-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(5-methoxy-1-methylindol-3-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102151331 |
| Molecular Formula | C24H29NO10 |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(5-methoxy-1-methylindol-3-yl)oxan-2-yl]methyl acetate |
| SMILES | COc1ccc2c(c1)c([C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O)cn2C |
| InChI | InChI=1S/C24H29NO10/c1-12(26)31-11-20-22(32-13(2)27)24(34-15(4)29)23(33-14(3)28)21(35-20)18-10-25(5)19-8-7-16(30-6)9-17(18)19/h7-10,20-24H,11H2,1-6H3/t20-,21+,22-,23+,24+/m1/s1 |
| InChIKey | MDTWYWSWXWIAQE-KNOCVWDGSA-N |
| XLogP | 1.99 |
| TPSA | 128.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|