C18H22IN5O7 — CID 87730935
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(ethylamino)-2-iodopurin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 87730935) has the molecular formula C18H22IN5O7 and a molecular weight of 547.31 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(ethylamino)-2-iodopurin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(ethylamino)-2-iodopurin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 87730935 |
| Molecular Formula | C18H22IN5O7 |
| Molecular Weight | 547.31 g/mol |
| Exact Mass | 547.06 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(ethylamino)-2-iodopurin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CCNc1nc(I)nc2c1ncn2[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H22IN5O7/c1-5-20-15-12-16(23-18(19)22-15)24(7-21-12)17-14(30-10(4)27)13(29-9(3)26)11(31-17)6-28-8(2)25/h7,11,13-14,17H,5-6H2,1-4H3,(H,20,22,23)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | GPGJBDBUFCUQEG-LSCFUAHRSA-N |
| XLogP | 1.19 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|