C19H22IN5O8 — CID 87662480
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(cyclopropyloxyamino)-2-iodopurin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 87662480) has the molecular formula C19H22IN5O8 and a molecular weight of 575.32 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(cyclopropyloxyamino)-2-iodopurin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(cyclopropyloxyamino)-2-iodopurin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 87662480 |
| Molecular Formula | C19H22IN5O8 |
| Molecular Weight | 575.32 g/mol |
| Exact Mass | 575.05 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(cyclopropyloxyamino)-2-iodopurin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(NOC4CC4)nc(I)nc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H22IN5O8/c1-8(26)29-6-12-14(30-9(2)27)15(31-10(3)28)18(32-12)25-7-21-13-16(24-33-11-4-5-11)22-19(20)23-17(13)25/h7,11-12,14-15,18H,4-6H2,1-3H3,(H,22,23,24)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | AMMXZSKIRQVUDO-SCFUHWHPSA-N |
| XLogP | 1.26 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|