C20H21IN6O7 — CID 87730742
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-iodo-6-(1H-pyrrol-3-ylamino)purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 87730742) has the molecular formula C20H21IN6O7 and a molecular weight of 584.33 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-iodo-6-(1H-pyrrol-3-ylamino)purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-iodo-6-(1H-pyrrol-3-ylamino)purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 87730742 |
| Molecular Formula | C20H21IN6O7 |
| Molecular Weight | 584.33 g/mol |
| Exact Mass | 584.05 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-iodo-6-(1H-pyrrol-3-ylamino)purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(Nc4cc[nH]c4)nc(I)nc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H21IN6O7/c1-9(28)31-7-13-15(32-10(2)29)16(33-11(3)30)19(34-13)27-8-23-14-17(24-12-4-5-22-6-12)25-20(21)26-18(14)27/h4-6,8,13,15-16,19,22H,7H2,1-3H3,(H,24,25,26)/t13-,15-,16-,19-/m1/s1 |
| InChIKey | XHVOJLIGNCHBBG-NVQRDWNXSA-N |
| XLogP | 1.83 |
| TPSA | 159.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|