C18H20N6O7S — CID 11798335
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-methyl-9-sulfanylidene-[1,2,4]triazolo[1,5-a]purin-3-yl)oxolan-2-yl]methyl acetate (PubChem CID 11798335) has the molecular formula C18H20N6O7S and a molecular weight of 464.46 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-methyl-9-sulfanylidene-[1,2,4]triazolo[1,5-a]purin-3-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-methyl-9-sulfanylidene-[1,2,4]triazolo[1,5-a]purin-3-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11798335 |
| Molecular Formula | C18H20N6O7S |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(5-methyl-9-sulfanylidene-[1,2,4]triazolo[1,5-a]purin-3-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(=S)n4ncn(C)c4nc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H20N6O7S/c1-8(25)28-5-11-13(29-9(2)26)14(30-10(3)27)16(31-11)23-6-19-12-15(23)21-18-22(4)7-20-24(18)17(12)32/h6-7,11,13-14,16H,5H2,1-4H3/t11-,13-,14-,16-/m1/s1 |
| InChIKey | VYOTXKXHSPJNRQ-XKVFNRALSA-N |
| XLogP | 0.47 |
| TPSA | 141.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|