C21H24N6O7 — CID 69199181
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-cyano-6-(cyclopropylmethylamino)purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 69199181) has the molecular formula C21H24N6O7 and a molecular weight of 472.46 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-cyano-6-(cyclopropylmethylamino)purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-cyano-6-(cyclopropylmethylamino)purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 69199181 |
| Molecular Formula | C21H24N6O7 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-cyano-6-(cyclopropylmethylamino)purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(NCC4CC4)nc(C#N)nc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H24N6O7/c1-10(28)31-8-14-17(32-11(2)29)18(33-12(3)30)21(34-14)27-9-24-16-19(23-7-13-4-5-13)25-15(6-22)26-20(16)27/h9,13-14,17-18,21H,4-5,7-8H2,1-3H3,(H,23,25,26)/t14-,17-,18-,21-/m1/s1 |
| InChIKey | IAIRSZLZAWMBTM-HAXDFEGKSA-N |
| XLogP | 0.84 |
| TPSA | 167.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|