C24H28N6O7 — CID 69197121
[3,4-diacetyloxy-5-[6-(2-bicyclo[2.2.1]heptanylamino)-2-cyanopurin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 69197121) has the molecular formula C24H28N6O7 and a molecular weight of 512.52 g/mol. Its IUPAC name is [3,4-diacetyloxy-5-[6-(2-bicyclo[2.2.1]heptanylamino)-2-cyanopurin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-5-[6-(2-bicyclo[2.2.1]heptanylamino)-2-cyanopurin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 69197121 |
| Molecular Formula | C24H28N6O7 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | [3,4-diacetyloxy-5-[6-(2-bicyclo[2.2.1]heptanylamino)-2-cyanopurin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(n2cnc3c(NC4CC5CCC4C5)nc(C#N)nc32)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C24H28N6O7/c1-11(31)34-9-17-20(35-12(2)32)21(36-13(3)33)24(37-17)30-10-26-19-22(28-18(8-25)29-23(19)30)27-16-7-14-4-5-15(16)6-14/h10,14-17,20-21,24H,4-7,9H2,1-3H3,(H,27,28,29) |
| InChIKey | HYFBZBWLHXNSNZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 167.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|