C23H30N6O9 — CID 11656694
[(2R,3R,4R,5R)-5-[2-acetamido-6-(2,2-dimethylpropanoylamino)purin-9-yl]-3,4-diacetyloxyoxolan-2-yl]methyl acetate (PubChem CID 11656694) has the molecular formula C23H30N6O9 and a molecular weight of 534.53 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[2-acetamido-6-(2,2-dimethylpropanoylamino)purin-9-yl]-3,4-diacetyloxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-5-[2-acetamido-6-(2,2-dimethylpropanoylamino)purin-9-yl]-3,4-diacetyloxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11656694 |
| Molecular Formula | C23H30N6O9 |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[2-acetamido-6-(2,2-dimethylpropanoylamino)purin-9-yl]-3,4-diacetyloxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)Nc1nc(NC(=O)C(C)(C)C)c2ncn([C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]3OC(C)=O)c2n1 |
| InChI | InChI=1S/C23H30N6O9/c1-10(30)25-22-27-18(26-21(34)23(5,6)7)15-19(28-22)29(9-24-15)20-17(37-13(4)33)16(36-12(3)32)14(38-20)8-35-11(2)31/h9,14,16-17,20H,8H2,1-7H3,(H2,25,26,27,28,30,34)/t14-,16-,17-,20-/m1/s1 |
| InChIKey | OAUYXOPYXHMBRC-WVSUBDOOSA-N |
| XLogP | 1.09 |
| TPSA | 189.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|