C25H30F3N5O11S — CID 158455403
[(2R,3R,4R,5R)-5-[6-acetamido-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]-3,4-diacetyloxyoxolan-2-yl]methyl acetate;acetyl acetate (PubChem CID 158455403) has the molecular formula C25H30F3N5O11S and a molecular weight of 665.60 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[6-acetamido-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]-3,4-diacetyloxyoxolan-2-yl]methyl acetate;acetyl acetate.
| Compound Name | [(2R,3R,4R,5R)-5-[6-acetamido-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]-3,4-diacetyloxyoxolan-2-yl]methyl acetate;acetyl acetate |
|---|---|
| PubChem CID | 158455403 |
| Molecular Formula | C25H30F3N5O11S |
| Molecular Weight | 665.60 g/mol |
| Exact Mass | 665.16 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[6-acetamido-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]-3,4-diacetyloxyoxolan-2-yl]methyl acetate;acetyl acetate |
| SMILES | CC(=O)Nc1nc(SCCC(F)(F)F)nc2c1ncn2[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O.CC(=O)OC(C)=O |
| InChI | InChI=1S/C21H24F3N5O8S.C4H6O3/c1-9(30)26-17-14-18(28-20(27-17)38-6-5-21(22,23)24)29(8-25-14)19-16(36-12(4)33)15(35-11(3)32)13(37-19)7-34-10(2)31;1-3(5)7-4(2)6/h8,13,15-16,19H,5-7H2,1-4H3,(H,26,27,28,30);1-2H3/t13-,15-,16-,19-;/m1./s1 |
| InChIKey | HEMUFBVOADXTTC-ZPXBPYQOSA-N |
| XLogP | 2.25 |
| TPSA | 204.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.60 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|