C15H20F3N5O4S — CID 67689646
(2R,3R,4S,5R)-2-[6-(ethylamino)-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 67689646) has the molecular formula C15H20F3N5O4S and a molecular weight of 423.42 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-(ethylamino)-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-(ethylamino)-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 67689646 |
| Molecular Formula | C15H20F3N5O4S |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-(ethylamino)-2-(3,3,3-trifluoropropylsulfanyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCNc1nc(SCCC(F)(F)F)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H20F3N5O4S/c1-2-19-11-8-12(22-14(21-11)28-4-3-15(16,17)18)23(6-20-8)13-10(26)9(25)7(5-24)27-13/h6-7,9-10,13,24-26H,2-5H2,1H3,(H,19,21,22)/t7-,9-,10-,13-/m1/s1 |
| InChIKey | AKJHRWCIFSDIKB-QYVSTXNMSA-N |
| XLogP | 0.91 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |